C52H53BN6O12S — CID 89307805
CID 89307805 (PubChem CID 89307805) has the molecular formula C52H53BN6O12S and a molecular weight of 996.90 g/mol.
| Compound Name | CID 89307805 |
|---|---|
| PubChem CID | 89307805 |
| Molecular Formula | C52H53BN6O12S |
| Molecular Weight | 996.90 g/mol |
| Exact Mass | 996.35 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C[C@H]2NC(=O)[C@H](Cc3cccs3)NC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)Nc3ccc(cc3)C[C@H](C(=O)N[C@@H](Cc3ccccc3)C(=O)O)NC(=O)[C@H](CCc3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C52H53BN6O12S/c1-30(60)70-44-45(71-31(2)61)51(67)58-42(29-38-14-9-25-72-38)49(65)57-40(26-34-15-20-36(53)21-16-34)47(63)55-39(24-19-32-10-5-3-6-11-32)46(62)56-41(27-35-17-22-37(23-18-35)54-50(44)66)48(64)59-43(52(68)69)28-33-12-7-4-8-13-33/h3-18,20-23,25,39-45H,19,24,26-29H2,1-2H3,(H,54,66)(H,55,63)(H,56,62)(H,57,65)(H,58,67)(H,59,64)(H,68,69)/t39-,40+,41+,42-,43-,44+,45+/m0/s1 |
| InChIKey | NQQHGRNLOLEYES-DFEJPGNSSA-N |
| XLogP | 1.77 |
| TPSA | 264.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 996.90 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|