About N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine
N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine (PubChem CID 89307931) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine |
| PubChem CID | 89307931 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine |
| SMILES | NCCCNCCC1=CC=C(N)CC1 |
| InChI | InChI=1S/C11H21N3/c12-7-1-8-14-9-6-10-2-4-11(13)5-3-10/h2,4,14H,1,3,5-9,12-13H2 |
| InChIKey | YRRWCOARIIZZKK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine?
The IUPAC name of N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine (CID 89307931) is N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine.
What is the SMILES notation for N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine?
The canonical SMILES for N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine is NCCCNCCC1=CC=C(N)CC1.
What is the InChIKey of N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine?
The InChIKey is YRRWCOARIIZZKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c12-7-1-8-14-9-6-10-2-4-11(13)5-3-10/h2,4,14H,1,3,5-9,12-13H2.
What are the key properties of N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine?
N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine has a molecular weight of 195.31 g/mol, XLogP of 0.88, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(4-aminocyclohexa-1,3-dien-1-yl)ethyl]propane-1,3-diamine is sourced from PubChem (CID 89307931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).