About 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate
2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate (PubChem CID 89307960) has the molecular formula C9H13F2NO4
and a molecular weight of 237.20 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate |
| PubChem CID | 89307960 |
| Molecular Formula | C9H13F2NO4 |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCC(F)F |
| InChI | InChI=1S/C9H13F2NO4/c1-6(2)8(13)15-4-3-12-9(14)16-5-7(10)11/h7H,1,3-5H2,2H3,(H,12,14) |
| InChIKey | PVWHFZRSCMHNIR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate?
The IUPAC name of 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate (CID 89307960) is 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate.
What is the SMILES notation for 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate?
The canonical SMILES for 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCNC(=O)OCC(F)F.
What is the InChIKey of 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate?
The InChIKey is PVWHFZRSCMHNIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO4/c1-6(2)8(13)15-4-3-12-9(14)16-5-7(10)11/h7H,1,3-5H2,2H3,(H,12,14).
What are the key properties of 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate?
2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate has a molecular weight of 237.20 g/mol, XLogP of 1.10, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethoxycarbonylamino)ethyl 2-methylprop-2-enoate is sourced from PubChem (CID 89307960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).