C7H9ClS — CID 89308104
(3Z,5E)-5-chlorohepta-1,3,5-triene-2-thiol (PubChem CID 89308104) has the molecular formula C7H9ClS and a molecular weight of 160.67 g/mol. Its IUPAC name is (3Z,5E)-5-chlorohepta-1,3,5-triene-2-thiol.
| Compound Name | (3Z,5E)-5-chlorohepta-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 89308104 |
| Molecular Formula | C7H9ClS |
| Molecular Weight | 160.67 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | (3Z,5E)-5-chlorohepta-1,3,5-triene-2-thiol |
| SMILES | C=C(S)/C=C\C(Cl)=C/C |
| InChI | InChI=1S/C7H9ClS/c1-3-7(8)5-4-6(2)9/h3-5,9H,2H2,1H3/b5-4-,7-3+ |
| InChIKey | MADJOFVLNXOHSY-SBYNAHCQSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.67 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|