C10H15N — CID 89308172
(4Z,7Z)-3,6,6-trimethyl-3H-azocine (PubChem CID 89308172) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (4Z,7Z)-3,6,6-trimethyl-3H-azocine.
| Compound Name | (4Z,7Z)-3,6,6-trimethyl-3H-azocine |
|---|---|
| PubChem CID | 89308172 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (4Z,7Z)-3,6,6-trimethyl-3H-azocine |
| SMILES | CC1/C=C\C(C)(C)/C=C\N=C/1 |
| InChI | InChI=1S/C10H15N/c1-9-4-5-10(2,3)6-7-11-8-9/h4-9H,1-3H3/b5-4-,7-6-,11-8- |
| InChIKey | WAPQMXONFUXBGL-WUIHLBFQSA-N |
| XLogP | 2.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|