C15H19N — CID 89308173
4-methyl-6-[(2E,4E,6Z)-octa-2,4,6-trien-4-yl]-4H-azepine (PubChem CID 89308173) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-methyl-6-[(2E,4E,6Z)-octa-2,4,6-trien-4-yl]-4H-azepine.
| Compound Name | 4-methyl-6-[(2E,4E,6Z)-octa-2,4,6-trien-4-yl]-4H-azepine |
|---|---|
| PubChem CID | 89308173 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 4-methyl-6-[(2E,4E,6Z)-octa-2,4,6-trien-4-yl]-4H-azepine |
| SMILES | C/C=C\C=C(/C=C/C)C1=CC(C)C=CN=C1 |
| InChI | InChI=1S/C15H19N/c1-4-6-8-14(7-5-2)15-11-13(3)9-10-16-12-15/h4-13H,1-3H3/b6-4-,7-5+,14-8+ |
| InChIKey | HTMGKCWVHRRGOH-GYZDKPECSA-N |
| XLogP | 4.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|