C27H50O9 — CID 89308209
13-hydroxy-3,7-bis(2-hydroxyethyl)-1,2,4,6,8,10,11-heptamethyltridecane-1,5,9-tricarboxylic acid (PubChem CID 89308209) has the molecular formula C27H50O9 and a molecular weight of 518.69 g/mol. Its IUPAC name is 13-hydroxy-3,7-bis(2-hydroxyethyl)-1,2,4,6,8,10,11-heptamethyltridecane-1,5,9-tricarboxylic acid.
| Compound Name | 13-hydroxy-3,7-bis(2-hydroxyethyl)-1,2,4,6,8,10,11-heptamethyltridecane-1,5,9-tricarboxylic acid |
|---|---|
| PubChem CID | 89308209 |
| Molecular Formula | C27H50O9 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | 13-hydroxy-3,7-bis(2-hydroxyethyl)-1,2,4,6,8,10,11-heptamethyltridecane-1,5,9-tricarboxylic acid |
| SMILES | CC(CCO)C(C)C(C(=O)O)C(C)C(CCO)C(C)C(C(=O)O)C(C)C(CCO)C(C)C(C)C(=O)O |
| InChI | InChI=1S/C27H50O9/c1-14(8-11-28)15(2)23(26(33)34)19(6)22(10-13-30)20(7)24(27(35)36)18(5)21(9-12-29)16(3)17(4)25(31)32/h14-24,28-30H,8-13H2,1-7H3,(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | UPAKEHCCCJDEJY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |