C15H14F6O2 — CID 89308675
1-[3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-4-hydroxyphenyl]-3-methylbut-3-en-2-one (PubChem CID 89308675) has the molecular formula C15H14F6O2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 1-[3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-4-hydroxyphenyl]-3-methylbut-3-en-2-one.
| Compound Name | 1-[3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-4-hydroxyphenyl]-3-methylbut-3-en-2-one |
|---|---|
| PubChem CID | 89308675 |
| Molecular Formula | C15H14F6O2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1-[3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-4-hydroxyphenyl]-3-methylbut-3-en-2-one |
| SMILES | C=C(C)C(=O)Cc1ccc(O)c(C(C)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14F6O2/c1-8(2)12(23)7-9-4-5-11(22)10(6-9)13(3,14(16,17)18)15(19,20)21/h4-6,22H,1,7H2,2-3H3 |
| InChIKey | AMFOYTOAIXCSNR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|