C18H10Cl4F3N3 — CID 89308779
1-[3-chloro-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-1,2,4-triazole (PubChem CID 89308779) has the molecular formula C18H10Cl4F3N3 and a molecular weight of 467.11 g/mol. Its IUPAC name is 1-[3-chloro-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-1,2,4-triazole.
| Compound Name | 1-[3-chloro-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 89308779 |
| Molecular Formula | C18H10Cl4F3N3 |
| Molecular Weight | 467.11 g/mol |
| Exact Mass | 464.96 |
| IUPAC Name | 1-[3-chloro-4-[(E)-4,4,4-trifluoro-3-(3,4,5-trichlorophenyl)but-1-enyl]phenyl]-1,2,4-triazole |
| SMILES | FC(F)(F)C(/C=C/c1ccc(-n2cncn2)cc1Cl)c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H10Cl4F3N3/c19-14-7-12(28-9-26-8-27-28)3-1-10(14)2-4-13(18(23,24)25)11-5-15(20)17(22)16(21)6-11/h1-9,13H/b4-2+ |
| InChIKey | NBFDZJOJWRMFFA-DUXPYHPUSA-N |
| XLogP | 7.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.11 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|