C18H11Cl2F3N4O2 — CID 89308803
1-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-3-nitro-1,2,4-triazole (PubChem CID 89308803) has the molecular formula C18H11Cl2F3N4O2 and a molecular weight of 443.21 g/mol. Its IUPAC name is 1-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-3-nitro-1,2,4-triazole.
| Compound Name | 1-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-3-nitro-1,2,4-triazole |
|---|---|
| PubChem CID | 89308803 |
| Molecular Formula | C18H11Cl2F3N4O2 |
| Molecular Weight | 443.21 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 1-[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-3-nitro-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ncn(-c2ccc(/C=C/C(c3cc(Cl)cc(Cl)c3)C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C18H11Cl2F3N4O2/c19-13-7-12(8-14(20)9-13)16(18(21,22)23)6-3-11-1-4-15(5-2-11)26-10-24-17(25-26)27(28)29/h1-10,16H/b6-3+ |
| InChIKey | BQBFCODHOMVYNC-ZZXKWVIFSA-N |
| XLogP | 5.84 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.21 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|