C10H13N — CID 89308813
(1R,2S,6R,7S)-2-methyl-4-azatricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 89308813) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (1R,2S,6R,7S)-2-methyl-4-azatricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | (1R,2S,6R,7S)-2-methyl-4-azatricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 89308813 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (1R,2S,6R,7S)-2-methyl-4-azatricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C[C@@]12C=NC[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C10H13N/c1-10-6-11-5-9(10)7-2-3-8(10)4-7/h2-3,6-9H,4-5H2,1H3/t7-,8+,9-,10+/m1/s1 |
| InChIKey | AGUQTUYWOVOXJL-RGOKHQFPSA-N |
| XLogP | 1.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|