C37H24F6N2O8 — CID 89309126
[5-[3-acetyloxy-4-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]phenyl]-2-methylphenyl] acetate (PubChem CID 89309126) has the molecular formula C37H24F6N2O8 and a molecular weight of 738.59 g/mol. Its IUPAC name is [5-[3-acetyloxy-4-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]phenyl]-2-methylphenyl] acetate.
| Compound Name | [5-[3-acetyloxy-4-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]phenyl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 89309126 |
| Molecular Formula | C37H24F6N2O8 |
| Molecular Weight | 738.59 g/mol |
| Exact Mass | 738.14 |
| IUPAC Name | [5-[3-acetyloxy-4-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]phenyl]-2-methylphenyl] acetate |
| SMILES | CC(=O)Oc1cc(-c2ccc(N3C(=O)c4ccc(C(c5ccc6c(c5)C(=O)N(C)C6=O)(C(F)(F)F)C(F)(F)F)cc4C3=O)c(OC(C)=O)c2)ccc1C |
| InChI | InChI=1S/C37H24F6N2O8/c1-17-5-6-20(13-29(17)52-18(2)46)21-7-12-28(30(14-21)53-19(3)47)45-33(50)25-11-9-23(16-27(25)34(45)51)35(36(38,39)40,37(41,42)43)22-8-10-24-26(15-22)32(49)44(4)31(24)48/h5-16H,1-4H3 |
| InChIKey | MLTMOJGAVOUCCU-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.59 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|