C19H25N3O2 — CID 89309262
1-(2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-1-cyclopropyl-3-methyl-3-(2-oxoethyl)urea (PubChem CID 89309262) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-(2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-1-cyclopropyl-3-methyl-3-(2-oxoethyl)urea.
| Compound Name | 1-(2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-1-cyclopropyl-3-methyl-3-(2-oxoethyl)urea |
|---|---|
| PubChem CID | 89309262 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-(2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-1-cyclopropyl-3-methyl-3-(2-oxoethyl)urea |
| SMILES | CN(CC=O)C(=O)N(C1CC1)C1c2ccccc2NC2CCCC21 |
| InChI | InChI=1S/C19H25N3O2/c1-21(11-12-23)19(24)22(13-9-10-13)18-14-5-2-3-7-16(14)20-17-8-4-6-15(17)18/h2-3,5,7,12-13,15,17-18,20H,4,6,8-11H2,1H3 |
| InChIKey | KJUCUEDZBPMIHN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|