About 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane
2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane (PubChem CID 89309503) has the molecular formula C13H7ClF4OS
and a molecular weight of 322.71 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane.
Molecular Properties
| Compound Name | 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane |
| PubChem CID | 89309503 |
| Molecular Formula | C13H7ClF4OS |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane |
| SMILES | Fc1ccc(C2(C(F)(F)c3ccc(Cl)s3)CO2)c(F)c1 |
| InChI | InChI=1S/C13H7ClF4OS/c14-11-4-3-10(20-11)13(17,18)12(6-19-12)8-2-1-7(15)5-9(8)16/h1-5H,6H2 |
| InChIKey | ODLIMUVSCYTGMD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane?
The IUPAC name of 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane (CID 89309503) is 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane.
What is the SMILES notation for 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane?
The canonical SMILES for 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane is Fc1ccc(C2(C(F)(F)c3ccc(Cl)s3)CO2)c(F)c1.
What is the InChIKey of 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane?
The InChIKey is ODLIMUVSCYTGMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7ClF4OS/c14-11-4-3-10(20-11)13(17,18)12(6-19-12)8-2-1-7(15)5-9(8)16/h1-5H,6H2.
What are the key properties of 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane?
2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane has a molecular weight of 322.71 g/mol, XLogP of 4.70, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chlorothiophen-2-yl)-difluoromethyl]-2-(2,4-difluorophenyl)oxirane is sourced from PubChem (CID 89309503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).