About 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone
2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone (PubChem CID 89309515) has the molecular formula C12H5ClF4N2O
and a molecular weight of 304.63 g/mol. Its IUPAC name is 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone |
| PubChem CID | 89309515 |
| Molecular Formula | C12H5ClF4N2O |
| Molecular Weight | 304.63 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone |
| SMILES | O=C(c1ccc(F)cc1F)C(F)(F)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C12H5ClF4N2O/c13-10-5-18-9(4-19-10)12(16,17)11(20)7-2-1-6(14)3-8(7)15/h1-5H |
| InChIKey | HPJCFRHGNKWHRQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone?
The IUPAC name of 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone (CID 89309515) is 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone.
What is the SMILES notation for 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone?
The canonical SMILES for 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone is O=C(c1ccc(F)cc1F)C(F)(F)c1cnc(Cl)cn1.
What is the InChIKey of 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone?
The InChIKey is HPJCFRHGNKWHRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5ClF4N2O/c13-10-5-18-9(4-19-10)12(16,17)11(20)7-2-1-6(14)3-8(7)15/h1-5H.
What are the key properties of 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone?
2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone has a molecular weight of 304.63 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloropyrazin-2-yl)-1-(2,4-difluorophenyl)-2,2-difluoroethanone is sourced from PubChem (CID 89309515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).