C20H28S — CID 89309580
6-[(4E)-2,6-dimethylhepta-4,6-dien-2-yl]-4,4-dimethyl-2,3-dihydrothiochromene (PubChem CID 89309580) has the molecular formula C20H28S and a molecular weight of 300.51 g/mol. Its IUPAC name is 6-[(4E)-2,6-dimethylhepta-4,6-dien-2-yl]-4,4-dimethyl-2,3-dihydrothiochromene.
| Compound Name | 6-[(4E)-2,6-dimethylhepta-4,6-dien-2-yl]-4,4-dimethyl-2,3-dihydrothiochromene |
|---|---|
| PubChem CID | 89309580 |
| Molecular Formula | C20H28S |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 6-[(4E)-2,6-dimethylhepta-4,6-dien-2-yl]-4,4-dimethyl-2,3-dihydrothiochromene |
| SMILES | C=C(C)/C=C/CC(C)(C)c1ccc2c(c1)C(C)(C)CCS2 |
| InChI | InChI=1S/C20H28S/c1-15(2)8-7-11-19(3,4)16-9-10-18-17(14-16)20(5,6)12-13-21-18/h7-10,14H,1,11-13H2,2-6H3/b8-7+ |
| InChIKey | VHTHUDBOIZXQNA-BQYQJAHWSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|