C19H23F3O9S2 — CID 89309622
2-(2-methylprop-2-enoyloxy)ethyl 4-(5,5,5-trifluoro-3-methylsulfonylpentyl)sulfonyloxybenzoate (PubChem CID 89309622) has the molecular formula C19H23F3O9S2 and a molecular weight of 516.51 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 4-(5,5,5-trifluoro-3-methylsulfonylpentyl)sulfonyloxybenzoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-(5,5,5-trifluoro-3-methylsulfonylpentyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 89309622 |
| Molecular Formula | C19H23F3O9S2 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 4-(5,5,5-trifluoro-3-methylsulfonylpentyl)sulfonyloxybenzoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)c1ccc(OS(=O)(=O)CCC(CC(F)(F)F)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H23F3O9S2/c1-13(2)17(23)29-9-10-30-18(24)14-4-6-15(7-5-14)31-33(27,28)11-8-16(32(3,25)26)12-19(20,21)22/h4-7,16H,1,8-12H2,2-3H3 |
| InChIKey | LWLLHDZUPJJHLI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|