C24H17Cl3F4N2O — CID 89309735
N-[(2-chloro-4-pyridinyl)methyl]-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methylbenzamide (PubChem CID 89309735) has the molecular formula C24H17Cl3F4N2O and a molecular weight of 531.76 g/mol. Its IUPAC name is N-[(2-chloro-4-pyridinyl)methyl]-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methylbenzamide.
| Compound Name | N-[(2-chloro-4-pyridinyl)methyl]-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 89309735 |
| Molecular Formula | C24H17Cl3F4N2O |
| Molecular Weight | 531.76 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | N-[(2-chloro-4-pyridinyl)methyl]-4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methylbenzamide |
| SMILES | Cc1cc(/C=C/C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)ccc1C(=O)NCc1ccnc(Cl)c1 |
| InChI | InChI=1S/C24H17Cl3F4N2O/c1-13-8-14(2-4-17(13)23(34)33-12-15-6-7-32-21(27)9-15)3-5-18(24(29,30)31)16-10-19(25)22(28)20(26)11-16/h2-11,18H,12H2,1H3,(H,33,34)/b5-3+ |
| InChIKey | WQPALRYXMGLMTG-HWKANZROSA-N |
| XLogP | 7.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.76 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|