C21H17Cl2F4NO2S — CID 89309773
4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methoxy-N-(thietan-3-yl)benzamide (PubChem CID 89309773) has the molecular formula C21H17Cl2F4NO2S and a molecular weight of 494.34 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methoxy-N-(thietan-3-yl)benzamide.
| Compound Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methoxy-N-(thietan-3-yl)benzamide |
|---|---|
| PubChem CID | 89309773 |
| Molecular Formula | C21H17Cl2F4NO2S |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methoxy-N-(thietan-3-yl)benzamide |
| SMILES | COc1cc(/C=C/C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)ccc1C(=O)NC1CSC1 |
| InChI | InChI=1S/C21H17Cl2F4NO2S/c1-30-18-6-11(2-4-14(18)20(29)28-13-9-31-10-13)3-5-15(21(25,26)27)12-7-16(22)19(24)17(23)8-12/h2-8,13,15H,9-10H2,1H3,(H,28,29)/b5-3+ |
| InChIKey | SXASBRKPWPAPFA-HWKANZROSA-N |
| XLogP | 6.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|