C15H13ClN2O6 — CID 89309832
(2S,3S,4S)-3-chloro-2-[3-(dihydroxyamino)phenyl]-3-nitro-2,4-dihydrochromen-4-ol (PubChem CID 89309832) has the molecular formula C15H13ClN2O6 and a molecular weight of 352.73 g/mol. Its IUPAC name is (2S,3S,4S)-3-chloro-2-[3-(dihydroxyamino)phenyl]-3-nitro-2,4-dihydrochromen-4-ol.
| Compound Name | (2S,3S,4S)-3-chloro-2-[3-(dihydroxyamino)phenyl]-3-nitro-2,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 89309832 |
| Molecular Formula | C15H13ClN2O6 |
| Molecular Weight | 352.73 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | (2S,3S,4S)-3-chloro-2-[3-(dihydroxyamino)phenyl]-3-nitro-2,4-dihydrochromen-4-ol |
| SMILES | O=[N+]([O-])[C@]1(Cl)[C@@H](O)c2ccccc2O[C@H]1c1cccc(N(O)O)c1 |
| InChI | InChI=1S/C15H13ClN2O6/c16-15(18(22)23)13(19)11-6-1-2-7-12(11)24-14(15)9-4-3-5-10(8-9)17(20)21/h1-8,13-14,19-21H/t13-,14-,15+/m0/s1 |
| InChIKey | XNNFRTKSMFMAOK-SOUVJXGZSA-N |
| XLogP | 2.65 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.73 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|