C39H41N3O5S — CID 89309968
[(4Z)-4-[[4-[2-[4-[(E)-2-(3,4-dimethylphenyl)-2-phenylethenyl]phenyl]pentan-2-ylamino]phenyl]methylidene]-1-ethyl-5-oxoimidazol-2-yl] hydrogen sulfate (PubChem CID 89309968) has the molecular formula C39H41N3O5S and a molecular weight of 663.84 g/mol. Its IUPAC name is [(4Z)-4-[[4-[2-[4-[(E)-2-(3,4-dimethylphenyl)-2-phenylethenyl]phenyl]pentan-2-ylamino]phenyl]methylidene]-1-ethyl-5-oxoimidazol-2-yl] hydrogen sulfate.
| Compound Name | [(4Z)-4-[[4-[2-[4-[(E)-2-(3,4-dimethylphenyl)-2-phenylethenyl]phenyl]pentan-2-ylamino]phenyl]methylidene]-1-ethyl-5-oxoimidazol-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 89309968 |
| Molecular Formula | C39H41N3O5S |
| Molecular Weight | 663.84 g/mol |
| Exact Mass | 663.28 |
| IUPAC Name | [(4Z)-4-[[4-[2-[4-[(E)-2-(3,4-dimethylphenyl)-2-phenylethenyl]phenyl]pentan-2-ylamino]phenyl]methylidene]-1-ethyl-5-oxoimidazol-2-yl] hydrogen sulfate |
| SMILES | CCCC(C)(Nc1ccc(/C=C2\N=C(OS(=O)(=O)O)N(CC)C2=O)cc1)c1ccc(/C=C(\c2ccccc2)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C39H41N3O5S/c1-6-23-39(5,41-34-21-16-30(17-22-34)26-36-37(43)42(7-2)38(40-36)47-48(44,45)46)33-19-14-29(15-20-33)25-35(31-11-9-8-10-12-31)32-18-13-27(3)28(4)24-32/h8-22,24-26,41H,6-7,23H2,1-5H3,(H,44,45,46)/b35-25+,36-26- |
| InChIKey | NJJQGXUQYJWCNP-GCZHPPLJSA-N |
| XLogP | 8.40 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.84 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|