C22H30O3 — CID 89310788
[(2E,7E)-3,7-dimethyl-4-oxo-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dien-5-ynyl] acetate (PubChem CID 89310788) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is [(2E,7E)-3,7-dimethyl-4-oxo-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dien-5-ynyl] acetate.
| Compound Name | [(2E,7E)-3,7-dimethyl-4-oxo-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dien-5-ynyl] acetate |
|---|---|
| PubChem CID | 89310788 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(2E,7E)-3,7-dimethyl-4-oxo-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,7-dien-5-ynyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)C(=O)C#C/C(C)=C/CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C22H30O3/c1-16(9-11-20-17(2)8-7-14-22(20,5)6)10-12-21(24)18(3)13-15-25-19(4)23/h9,13H,7-8,11,14-15H2,1-6H3/b16-9+,18-13+ |
| InChIKey | HWTAHDYIVQEYSX-QCEWELCBSA-N |
| XLogP | 4.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|