C14H18F3NO3 — CID 893108
N-cyclohexyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide (PubChem CID 893108) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is N-cyclohexyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide.
| Compound Name | N-cyclohexyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 893108 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-cyclohexyl-5-(2,2,2-trifluoroethoxymethyl)furan-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccc(COCC(F)(F)F)o1 |
| InChI | InChI=1S/C14H18F3NO3/c15-14(16,17)9-20-8-11-6-7-12(21-11)13(19)18-10-4-2-1-3-5-10/h6-7,10H,1-5,8-9H2,(H,18,19) |
| InChIKey | HLZVOVNCWRHWSC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |