C19H9Cl3F7N3O2 — CID 89310938
methyl 2-chloro-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]benzoate (PubChem CID 89310938) has the molecular formula C19H9Cl3F7N3O2 and a molecular weight of 550.65 g/mol. Its IUPAC name is methyl 2-chloro-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]benzoate.
| Compound Name | methyl 2-chloro-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]benzoate |
|---|---|
| PubChem CID | 89310938 |
| Molecular Formula | C19H9Cl3F7N3O2 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 548.96 |
| IUPAC Name | methyl 2-chloro-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]triazol-4-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2cn(-c3c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3Cl)nn2)ccc1Cl |
| InChI | InChI=1S/C19H9Cl3F7N3O2/c1-34-16(33)10-4-8(2-3-11(10)20)14-7-32(31-30-14)15-12(21)5-9(6-13(15)22)17(23,18(24,25)26)19(27,28)29/h2-7H,1H3 |
| InChIKey | PPHXZIXMHUZVDD-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |