About 1-piperidin-4-yl-1,4-diazepan-2-one
1-piperidin-4-yl-1,4-diazepan-2-one (PubChem CID 89310976) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-piperidin-4-yl-1,4-diazepan-2-one.
Molecular Properties
| Compound Name | 1-piperidin-4-yl-1,4-diazepan-2-one |
| PubChem CID | 89310976 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-piperidin-4-yl-1,4-diazepan-2-one |
| SMILES | O=C1CNCCCN1C1CCNCC1 |
| InChI | InChI=1S/C10H19N3O/c14-10-8-12-4-1-7-13(10)9-2-5-11-6-3-9/h9,11-12H,1-8H2 |
| InChIKey | AKVXAUKYFYGAQV-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-piperidin-4-yl-1,4-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-4-yl-1,4-diazepan-2-one?
The IUPAC name of 1-piperidin-4-yl-1,4-diazepan-2-one (CID 89310976) is 1-piperidin-4-yl-1,4-diazepan-2-one.
What is the SMILES notation for 1-piperidin-4-yl-1,4-diazepan-2-one?
The canonical SMILES for 1-piperidin-4-yl-1,4-diazepan-2-one is O=C1CNCCCN1C1CCNCC1.
What is the InChIKey of 1-piperidin-4-yl-1,4-diazepan-2-one?
The InChIKey is AKVXAUKYFYGAQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c14-10-8-12-4-1-7-13(10)9-2-5-11-6-3-9/h9,11-12H,1-8H2.
What are the key properties of 1-piperidin-4-yl-1,4-diazepan-2-one?
1-piperidin-4-yl-1,4-diazepan-2-one has a molecular weight of 197.28 g/mol, XLogP of -0.44, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-4-yl-1,4-diazepan-2-one is sourced from PubChem (CID 89310976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).