C21H40O4 — CID 89311256
(5E)-7-(6-hydroxy-6-methylundecan-2-yl)oxy-3-methylocta-1,5-diene-2,7-diol (PubChem CID 89311256) has the molecular formula C21H40O4 and a molecular weight of 356.55 g/mol. Its IUPAC name is (5E)-7-(6-hydroxy-6-methylundecan-2-yl)oxy-3-methylocta-1,5-diene-2,7-diol.
| Compound Name | (5E)-7-(6-hydroxy-6-methylundecan-2-yl)oxy-3-methylocta-1,5-diene-2,7-diol |
|---|---|
| PubChem CID | 89311256 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | (5E)-7-(6-hydroxy-6-methylundecan-2-yl)oxy-3-methylocta-1,5-diene-2,7-diol |
| SMILES | C=C(O)C(C)C/C=C/C(C)(O)OC(C)CCCC(C)(O)CCCCC |
| InChI | InChI=1S/C21H40O4/c1-7-8-9-14-20(5,23)15-11-13-18(3)25-21(6,24)16-10-12-17(2)19(4)22/h10,16-18,22-24H,4,7-9,11-15H2,1-3,5-6H3/b16-10+ |
| InChIKey | HUKFSGRBRXRBAU-MHWRWJLKSA-N |
| XLogP | 5.26 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|