C23H25ClN6O4 — CID 89311456
2-[[(3R)-1-[2-chloro-4-[1-(2-methyliminohydrazinyl)ethenyl]benzoyl]-3-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carbonyl]amino]acetic acid (PubChem CID 89311456) has the molecular formula C23H25ClN6O4 and a molecular weight of 484.94 g/mol. Its IUPAC name is 2-[[(3R)-1-[2-chloro-4-[1-(2-methyliminohydrazinyl)ethenyl]benzoyl]-3-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carbonyl]amino]acetic acid.
| Compound Name | 2-[[(3R)-1-[2-chloro-4-[1-(2-methyliminohydrazinyl)ethenyl]benzoyl]-3-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 89311456 |
| Molecular Formula | C23H25ClN6O4 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-[[(3R)-1-[2-chloro-4-[1-(2-methyliminohydrazinyl)ethenyl]benzoyl]-3-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carbonyl]amino]acetic acid |
| SMILES | C=C(N/N=N/C)c1ccc(C(=O)N2C[C@@H](C)N(C(=O)NCC(=O)O)Cc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C23H25ClN6O4/c1-14-12-30(22(33)18-9-8-16(10-19(18)24)15(2)27-28-25-3)20-7-5-4-6-17(20)13-29(14)23(34)26-11-21(31)32/h4-10,14H,2,11-13H2,1,3H3,(H,25,27)(H,26,34)(H,31,32)/t14-/m1/s1 |
| InChIKey | YURQFVQVTYCFBA-CQSZACIVSA-N |
| XLogP | 3.54 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|