C11H16ClN — CID 89311498
4-[(3E,5E)-6-chlorohexa-1,3,5-trien-3-yl]piperidine (PubChem CID 89311498) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is 4-[(3E,5E)-6-chlorohexa-1,3,5-trien-3-yl]piperidine.
| Compound Name | 4-[(3E,5E)-6-chlorohexa-1,3,5-trien-3-yl]piperidine |
|---|---|
| PubChem CID | 89311498 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 4-[(3E,5E)-6-chlorohexa-1,3,5-trien-3-yl]piperidine |
| SMILES | C=C/C(=C\C=C\Cl)C1CCNCC1 |
| InChI | InChI=1S/C11H16ClN/c1-2-10(4-3-7-12)11-5-8-13-9-6-11/h2-4,7,11,13H,1,5-6,8-9H2/b7-3+,10-4+ |
| InChIKey | BECQQGUJWFHOIM-DROBUMMNSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|