C14H16Cl2N2O — CID 89311599
N-[(E)-2-[[(3Z,5E)-5-chloro-2-methylidenehepta-3,5-dienoyl]amino]prop-1-enyl]prop-2-enimidoyl chloride (PubChem CID 89311599) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is N-[(E)-2-[[(3Z,5E)-5-chloro-2-methylidenehepta-3,5-dienoyl]amino]prop-1-enyl]prop-2-enimidoyl chloride.
| Compound Name | N-[(E)-2-[[(3Z,5E)-5-chloro-2-methylidenehepta-3,5-dienoyl]amino]prop-1-enyl]prop-2-enimidoyl chloride |
|---|---|
| PubChem CID | 89311599 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-[(E)-2-[[(3Z,5E)-5-chloro-2-methylidenehepta-3,5-dienoyl]amino]prop-1-enyl]prop-2-enimidoyl chloride |
| SMILES | C=C/C(Cl)=N/C=C(\C)NC(=O)C(=C)/C=C\C(Cl)=C/C |
| InChI | InChI=1S/C14H16Cl2N2O/c1-5-12(15)8-7-10(3)14(19)18-11(4)9-17-13(16)6-2/h5-9H,2-3H2,1,4H3,(H,18,19)/b8-7-,11-9+,12-5+,17-13- |
| InChIKey | CAOQAHVXBLADLS-DYOJZAIOSA-N |
| XLogP | 4.04 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|