C9H7ClN4OS — CID 89311605
5-amino-N-(6-chloro-3-pyridinyl)-1,3-thiazole-2-carboxamide (PubChem CID 89311605) has the molecular formula C9H7ClN4OS and a molecular weight of 254.70 g/mol. Its IUPAC name is 5-amino-N-(6-chloro-3-pyridinyl)-1,3-thiazole-2-carboxamide.
| Compound Name | 5-amino-N-(6-chloro-3-pyridinyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 89311605 |
| Molecular Formula | C9H7ClN4OS |
| Molecular Weight | 254.70 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 5-amino-N-(6-chloro-3-pyridinyl)-1,3-thiazole-2-carboxamide |
| SMILES | Nc1cnc(C(=O)Nc2ccc(Cl)nc2)s1 |
| InChI | InChI=1S/C9H7ClN4OS/c10-6-2-1-5(3-12-6)14-8(15)9-13-4-7(11)16-9/h1-4H,11H2,(H,14,15) |
| InChIKey | QKOOSJZTWDSBQI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.70 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|