About 4-fluoropyrrolidin-2-ol
4-fluoropyrrolidin-2-ol (PubChem CID 89311737) has the molecular formula C4H8FNO
and a molecular weight of 105.11 g/mol. Its IUPAC name is 4-fluoropyrrolidin-2-ol.
Molecular Properties
| Compound Name | 4-fluoropyrrolidin-2-ol |
| PubChem CID | 89311737 |
| Molecular Formula | C4H8FNO |
| Molecular Weight | 105.11 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | 4-fluoropyrrolidin-2-ol |
| SMILES | OC1CC(F)CN1 |
| InChI | InChI=1S/C4H8FNO/c5-3-1-4(7)6-2-3/h3-4,6-7H,1-2H2 |
| InChIKey | UVRURXNSMZAAOU-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.11 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoropyrrolidin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoropyrrolidin-2-ol?
The IUPAC name of 4-fluoropyrrolidin-2-ol (CID 89311737) is 4-fluoropyrrolidin-2-ol.
What is the SMILES notation for 4-fluoropyrrolidin-2-ol?
The canonical SMILES for 4-fluoropyrrolidin-2-ol is OC1CC(F)CN1.
What is the InChIKey of 4-fluoropyrrolidin-2-ol?
The InChIKey is UVRURXNSMZAAOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8FNO/c5-3-1-4(7)6-2-3/h3-4,6-7H,1-2H2.
What are the key properties of 4-fluoropyrrolidin-2-ol?
4-fluoropyrrolidin-2-ol has a molecular weight of 105.11 g/mol, XLogP of -0.36, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoropyrrolidin-2-ol is sourced from PubChem (CID 89311737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).