C13H14FNS — CID 89311770
(1Z,3E)-3-(2-fluoro-4-methylphenyl)sulfanylhexa-1,3,5-trien-1-amine (PubChem CID 89311770) has the molecular formula C13H14FNS and a molecular weight of 235.33 g/mol. Its IUPAC name is (1Z,3E)-3-(2-fluoro-4-methylphenyl)sulfanylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-3-(2-fluoro-4-methylphenyl)sulfanylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89311770 |
| Molecular Formula | C13H14FNS |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | (1Z,3E)-3-(2-fluoro-4-methylphenyl)sulfanylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(\C=C/N)Sc1ccc(C)cc1F |
| InChI | InChI=1S/C13H14FNS/c1-3-4-11(7-8-15)16-13-6-5-10(2)9-12(13)14/h3-9H,1,15H2,2H3/b8-7-,11-4+ |
| InChIKey | VSANHGHDIKTOTM-WJMWGRLLSA-N |
| XLogP | 3.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|