About (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine
(3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine (PubChem CID 89311785) has the molecular formula C16H33N
and a molecular weight of 239.45 g/mol. Its IUPAC name is (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine.
Molecular Properties
| Compound Name | (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine |
| PubChem CID | 89311785 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine |
| SMILES | C=C([C@H](CCCCCCC)CC(C)C)N(C)C |
| InChI | InChI=1S/C16H33N/c1-7-8-9-10-11-12-16(13-14(2)3)15(4)17(5)6/h14,16H,4,7-13H2,1-3,5-6H3/t16-/m1/s1 |
| InChIKey | CEZPNAUWSQUFIW-MRXNPFEDSA-N |
| XLogP | 5.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine?
The IUPAC name of (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine (CID 89311785) is (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine.
What is the SMILES notation for (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine?
The canonical SMILES for (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine is C=C([C@H](CCCCCCC)CC(C)C)N(C)C.
What is the InChIKey of (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine?
The InChIKey is CEZPNAUWSQUFIW-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H33N/c1-7-8-9-10-11-12-16(13-14(2)3)15(4)17(5)6/h14,16H,4,7-13H2,1-3,5-6H3/t16-/m1/s1.
What are the key properties of (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine?
(3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine has a molecular weight of 239.45 g/mol, XLogP of 5.08, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N,N-dimethyl-3-(2-methylpropyl)dec-1-en-2-amine is sourced from PubChem (CID 89311785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).