About (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene
(2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene (PubChem CID 89311801) has the molecular formula C8H11F3O2S
and a molecular weight of 228.23 g/mol. Its IUPAC name is (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene.
Molecular Properties
| Compound Name | (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene |
| PubChem CID | 89311801 |
| Molecular Formula | C8H11F3O2S |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene |
| SMILES | C/C=C(C)\C=C(/C)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O2S/c1-4-6(2)5-7(3)14(12,13)8(9,10)11/h4-5H,1-3H3/b6-4-,7-5+ |
| InChIKey | FXXCIFBTFRUEPA-XGXWUAJZSA-N |
| XLogP | 2.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene?
The IUPAC name of (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene (CID 89311801) is (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene.
What is the SMILES notation for (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene?
The canonical SMILES for (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene is C/C=C(C)\C=C(/C)S(=O)(=O)C(F)(F)F.
What is the InChIKey of (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene?
The InChIKey is FXXCIFBTFRUEPA-XGXWUAJZSA-N. The full InChI is InChI=1S/C8H11F3O2S/c1-4-6(2)5-7(3)14(12,13)8(9,10)11/h4-5H,1-3H3/b6-4-,7-5+.
What are the key properties of (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene?
(2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene has a molecular weight of 228.23 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-4-methyl-2-(trifluoromethylsulfonyl)hexa-2,4-diene is sourced from PubChem (CID 89311801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).