C18H33NO13 — CID 89312257
3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]amino]propoxy]propanoic acid (PubChem CID 89312257) has the molecular formula C18H33NO13 and a molecular weight of 471.46 g/mol. Its IUPAC name is 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]amino]propoxy]propanoic acid.
| Compound Name | 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]amino]propoxy]propanoic acid |
|---|---|
| PubChem CID | 89312257 |
| Molecular Formula | C18H33NO13 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 3-[3-(2-carboxyethoxy)-2-(2-carboxyethoxymethyl)-2-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]amino]propoxy]propanoic acid |
| SMILES | O=C(O)CCOCC(COCCC(=O)O)(COCCC(=O)O)NC[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C18H33NO13/c20-8-13(22)17(29)12(21)7-19-18(9-30-4-1-14(23)24,10-31-5-2-15(25)26)11-32-6-3-16(27)28/h12-13,17,19-22,29H,1-11H2,(H,23,24)(H,25,26)(H,27,28)/t12-,13+,17+/m0/s1 |
| InChIKey | HOFDYJXBRRVZSA-OGHNNQOOSA-N |
| XLogP | -3.14 |
| TPSA | 232.54 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|