C30H57NO13 — CID 89312282
tert-butyl 3-[3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]-2-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]methyl]-2-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]amino]propoxy]propanoate (PubChem CID 89312282) has the molecular formula C30H57NO13 and a molecular weight of 639.78 g/mol. Its IUPAC name is tert-butyl 3-[3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]-2-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]methyl]-2-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]amino]propoxy]propanoate.
| Compound Name | tert-butyl 3-[3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]-2-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]methyl]-2-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]amino]propoxy]propanoate |
|---|---|
| PubChem CID | 89312282 |
| Molecular Formula | C30H57NO13 |
| Molecular Weight | 639.78 g/mol |
| Exact Mass | 639.38 |
| IUPAC Name | tert-butyl 3-[3-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]-2-[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]methyl]-2-[[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]amino]propoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCC(COCCC(=O)OC(C)(C)C)(COCCC(=O)OC(C)(C)C)NC[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C30H57NO13/c1-27(2,3)42-23(35)10-13-39-18-30(31-16-21(33)26(38)22(34)17-32,19-40-14-11-24(36)43-28(4,5)6)20-41-15-12-25(37)44-29(7,8)9/h21-22,26,31-34,38H,10-20H2,1-9H3/t21-,22+,26+/m0/s1 |
| InChIKey | XYALMUVYAWUFQI-VVZHRXSXSA-N |
| XLogP | 0.63 |
| TPSA | 199.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.78 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|