C13H19NO — CID 89312769
1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]piperidin-4-one (PubChem CID 89312769) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]piperidin-4-one.
| Compound Name | 1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]piperidin-4-one |
|---|---|
| PubChem CID | 89312769 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-[(2E,4Z,6Z)-octa-2,4,6-trienyl]piperidin-4-one |
| SMILES | C/C=C\C=C/C=C/CN1CCC(=O)CC1 |
| InChI | InChI=1S/C13H19NO/c1-2-3-4-5-6-7-10-14-11-8-13(15)9-12-14/h2-7H,8-12H2,1H3/b3-2-,5-4-,7-6+ |
| InChIKey | WZUAZTMLRKYHNV-MUVPYGFYSA-N |
| XLogP | 2.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|