C15H25FO — CID 89312914
(2Z,4E,6E)-5-(1-fluoro-2-methylpropoxy)-9-methyldeca-2,4,6-triene (PubChem CID 89312914) has the molecular formula C15H25FO and a molecular weight of 240.36 g/mol. Its IUPAC name is (2Z,4E,6E)-5-(1-fluoro-2-methylpropoxy)-9-methyldeca-2,4,6-triene.
| Compound Name | (2Z,4E,6E)-5-(1-fluoro-2-methylpropoxy)-9-methyldeca-2,4,6-triene |
|---|---|
| PubChem CID | 89312914 |
| Molecular Formula | C15H25FO |
| Molecular Weight | 240.36 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (2Z,4E,6E)-5-(1-fluoro-2-methylpropoxy)-9-methyldeca-2,4,6-triene |
| SMILES | C/C=C\C=C(/C=C/CC(C)C)OC(F)C(C)C |
| InChI | InChI=1S/C15H25FO/c1-6-7-10-14(11-8-9-12(2)3)17-15(16)13(4)5/h6-8,10-13,15H,9H2,1-5H3/b7-6-,11-8+,14-10+ |
| InChIKey | PGZZIWGUERQTHD-NSAHAEETSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|