About [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine
[4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine (PubChem CID 89313156) has the molecular formula C8H12I2N2
and a molecular weight of 390.01 g/mol. Its IUPAC name is [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine.
Molecular Properties
| Compound Name | [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine |
| PubChem CID | 89313156 |
| Molecular Formula | C8H12I2N2 |
| Molecular Weight | 390.01 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine |
| SMILES | NNC1C=CC(CI)=CC1CI |
| InChI | InChI=1S/C8H12I2N2/c9-4-6-1-2-8(12-11)7(3-6)5-10/h1-3,7-8,12H,4-5,11H2 |
| InChIKey | QAJVTYKMMSKNDF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.01 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine?
The IUPAC name of [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine (CID 89313156) is [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine.
What is the SMILES notation for [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine?
The canonical SMILES for [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine is NNC1C=CC(CI)=CC1CI.
What is the InChIKey of [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine?
The InChIKey is QAJVTYKMMSKNDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12I2N2/c9-4-6-1-2-8(12-11)7(3-6)5-10/h1-3,7-8,12H,4-5,11H2.
What are the key properties of [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine?
[4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine has a molecular weight of 390.01 g/mol, XLogP of 1.80, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4,6-bis(iodomethyl)cyclohexa-2,4-dien-1-yl]hydrazine is sourced from PubChem (CID 89313156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).