C11H19N — CID 89313204
(1Z,3Z)-N-butyl-3-methylhexa-1,3,5-trien-1-amine (PubChem CID 89313204) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (1Z,3Z)-N-butyl-3-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-N-butyl-3-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89313204 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (1Z,3Z)-N-butyl-3-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(C)\C=C/NCCCC |
| InChI | InChI=1S/C11H19N/c1-4-6-9-12-10-8-11(3)7-5-2/h5,7-8,10,12H,2,4,6,9H2,1,3H3/b10-8-,11-7- |
| InChIKey | LFUNHVFRXKCWQD-ACBQZUGDSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|