About 3,5-dimethyl-1,2-dihydropyridin-2-ol
3,5-dimethyl-1,2-dihydropyridin-2-ol (PubChem CID 89313212) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 3,5-dimethyl-1,2-dihydropyridin-2-ol.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,2-dihydropyridin-2-ol |
| PubChem CID | 89313212 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 3,5-dimethyl-1,2-dihydropyridin-2-ol |
| SMILES | CC1=CNC(O)C(C)=C1 |
| InChI | InChI=1S/C7H11NO/c1-5-3-6(2)7(9)8-4-5/h3-4,7-9H,1-2H3 |
| InChIKey | UUPWUVYUZNLGQV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-1,2-dihydropyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,2-dihydropyridin-2-ol?
The IUPAC name of 3,5-dimethyl-1,2-dihydropyridin-2-ol (CID 89313212) is 3,5-dimethyl-1,2-dihydropyridin-2-ol.
What is the SMILES notation for 3,5-dimethyl-1,2-dihydropyridin-2-ol?
The canonical SMILES for 3,5-dimethyl-1,2-dihydropyridin-2-ol is CC1=CNC(O)C(C)=C1.
What is the InChIKey of 3,5-dimethyl-1,2-dihydropyridin-2-ol?
The InChIKey is UUPWUVYUZNLGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-5-3-6(2)7(9)8-4-5/h3-4,7-9H,1-2H3.
What are the key properties of 3,5-dimethyl-1,2-dihydropyridin-2-ol?
3,5-dimethyl-1,2-dihydropyridin-2-ol has a molecular weight of 125.17 g/mol, XLogP of 0.76, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,2-dihydropyridin-2-ol is sourced from PubChem (CID 89313212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).