C6H12NO5+ — CID 89313259
1-hydroxy-2-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-1-ium-3,4,5-triol (PubChem CID 89313259) has the molecular formula C6H12NO5+ and a molecular weight of 178.16 g/mol. Its IUPAC name is 1-hydroxy-2-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-1-ium-3,4,5-triol.
| Compound Name | 1-hydroxy-2-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-1-ium-3,4,5-triol |
|---|---|
| PubChem CID | 89313259 |
| Molecular Formula | C6H12NO5+ |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 1-hydroxy-2-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-1-ium-3,4,5-triol |
| SMILES | OCC1C(O)C(O)C(O)C=[N+]1O |
| InChI | InChI=1S/C6H12NO5/c8-2-3-5(10)6(11)4(9)1-7(3)12/h1,3-6,8-12H,2H2/q+1 |
| InChIKey | HHDSCVGNWDDLPE-UHFFFAOYSA-N |
| XLogP | -3.08 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|