About 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine
1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine (PubChem CID 89313271) has the molecular formula C21H30ClF2N3
and a molecular weight of 397.94 g/mol. Its IUPAC name is 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine.
Molecular Properties
| Compound Name | 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine |
| PubChem CID | 89313271 |
| Molecular Formula | C21H30ClF2N3 |
| Molecular Weight | 397.94 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine |
| SMILES | C=C(C)CN1CCC(CCN2CCN(c3ccc(F)c(Cl)c3F)CC2)CC1 |
| InChI | InChI=1S/C21H30ClF2N3/c1-16(2)15-26-9-6-17(7-10-26)5-8-25-11-13-27(14-12-25)19-4-3-18(23)20(22)21(19)24/h3-4,17H,1,5-15H2,2H3 |
| InChIKey | OFJLZGHZASTMJL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.94 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine?
The IUPAC name of 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine (CID 89313271) is 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine.
What is the SMILES notation for 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine?
The canonical SMILES for 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine is C=C(C)CN1CCC(CCN2CCN(c3ccc(F)c(Cl)c3F)CC2)CC1.
What is the InChIKey of 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine?
The InChIKey is OFJLZGHZASTMJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30ClF2N3/c1-16(2)15-26-9-6-17(7-10-26)5-8-25-11-13-27(14-12-25)19-4-3-18(23)20(22)21(19)24/h3-4,17H,1,5-15H2,2H3.
What are the key properties of 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine?
1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine has a molecular weight of 397.94 g/mol, XLogP of 4.42, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-2,4-difluorophenyl)-4-[2-[1-(2-methylprop-2-enyl)piperidin-4-yl]ethyl]piperazine is sourced from PubChem (CID 89313271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).