About 1-hydroxypiperidine-3,4,5-triol
1-hydroxypiperidine-3,4,5-triol (PubChem CID 89313318) has the molecular formula C5H11NO4
and a molecular weight of 149.15 g/mol. Its IUPAC name is 1-hydroxypiperidine-3,4,5-triol.
Molecular Properties
| Compound Name | 1-hydroxypiperidine-3,4,5-triol |
| PubChem CID | 89313318 |
| Molecular Formula | C5H11NO4 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 1-hydroxypiperidine-3,4,5-triol |
| SMILES | OC1CN(O)CC(O)C1O |
| InChI | InChI=1S/C5H11NO4/c7-3-1-6(10)2-4(8)5(3)9/h3-5,7-10H,1-2H2 |
| InChIKey | BKBUECIYHLEVTR-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-hydroxypiperidine-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypiperidine-3,4,5-triol?
The IUPAC name of 1-hydroxypiperidine-3,4,5-triol (CID 89313318) is 1-hydroxypiperidine-3,4,5-triol.
What is the SMILES notation for 1-hydroxypiperidine-3,4,5-triol?
The canonical SMILES for 1-hydroxypiperidine-3,4,5-triol is OC1CN(O)CC(O)C1O.
What is the InChIKey of 1-hydroxypiperidine-3,4,5-triol?
The InChIKey is BKBUECIYHLEVTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO4/c7-3-1-6(10)2-4(8)5(3)9/h3-5,7-10H,1-2H2.
What are the key properties of 1-hydroxypiperidine-3,4,5-triol?
1-hydroxypiperidine-3,4,5-triol has a molecular weight of 149.15 g/mol, XLogP of -2.23, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypiperidine-3,4,5-triol is sourced from PubChem (CID 89313318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).