C24H40S — CID 89313355
(1R,3R,5S)-1-[(E)-hept-2-en-2-yl]-3-methyl-5-[(4R)-4-methylcyclohexen-1-yl]-2-prop-1-en-2-ylsulfanylcyclohexane (PubChem CID 89313355) has the molecular formula C24H40S and a molecular weight of 360.65 g/mol. Its IUPAC name is (1R,3R,5S)-1-[(E)-hept-2-en-2-yl]-3-methyl-5-[(4R)-4-methylcyclohexen-1-yl]-2-prop-1-en-2-ylsulfanylcyclohexane.
| Compound Name | (1R,3R,5S)-1-[(E)-hept-2-en-2-yl]-3-methyl-5-[(4R)-4-methylcyclohexen-1-yl]-2-prop-1-en-2-ylsulfanylcyclohexane |
|---|---|
| PubChem CID | 89313355 |
| Molecular Formula | C24H40S |
| Molecular Weight | 360.65 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | (1R,3R,5S)-1-[(E)-hept-2-en-2-yl]-3-methyl-5-[(4R)-4-methylcyclohexen-1-yl]-2-prop-1-en-2-ylsulfanylcyclohexane |
| SMILES | C=C(C)SC1[C@H](C)C[C@H](C2=CC[C@H](C)CC2)C[C@@H]1/C(C)=C/CCCC |
| InChI | InChI=1S/C24H40S/c1-7-8-9-10-19(5)23-16-22(21-13-11-18(4)12-14-21)15-20(6)24(23)25-17(2)3/h10,13,18,20,22-24H,2,7-9,11-12,14-16H2,1,3-6H3/b19-10+/t18-,20+,22-,23+,24?/m0/s1 |
| InChIKey | PPMBBUSLBJBQHR-WNZZTMROSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.65 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|