About (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol
(5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol (PubChem CID 89313359) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol.
Molecular Properties
| Compound Name | (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol |
| PubChem CID | 89313359 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol |
| SMILES | OCC1=NCCC[C@@H]1O |
| InChI | InChI=1S/C6H11NO2/c8-4-5-6(9)2-1-3-7-5/h6,8-9H,1-4H2/t6-/m0/s1 |
| InChIKey | UPHIFXDJUSLXEX-LURJTMIESA-N |
| XLogP | -0.43 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol?
The IUPAC name of (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol (CID 89313359) is (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol.
What is the SMILES notation for (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol?
The canonical SMILES for (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol is OCC1=NCCC[C@@H]1O.
What is the InChIKey of (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol?
The InChIKey is UPHIFXDJUSLXEX-LURJTMIESA-N. The full InChI is InChI=1S/C6H11NO2/c8-4-5-6(9)2-1-3-7-5/h6,8-9H,1-4H2/t6-/m0/s1.
What are the key properties of (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol?
(5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol has a molecular weight of 129.16 g/mol, XLogP of -0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-6-(hydroxymethyl)-2,3,4,5-tetrahydropyridin-5-ol is sourced from PubChem (CID 89313359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).