About (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide
(2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide (PubChem CID 89313443) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide.
Molecular Properties
| Compound Name | (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide |
| PubChem CID | 89313443 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide |
| SMILES | C=CC[C@H](C(N)=O)C(CC1CCC1)C(=O)NCC |
| InChI | InChI=1S/C14H24N2O2/c1-3-6-11(13(15)17)12(14(18)16-4-2)9-10-7-5-8-10/h3,10-12H,1,4-9H2,2H3,(H2,15,17)(H,16,18)/t11-,12?/m0/s1 |
| InChIKey | QGVDAAYOCNUOCC-PXYINDEMSA-N |
| XLogP | 1.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide?
The IUPAC name of (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide (CID 89313443) is (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide.
What is the SMILES notation for (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide?
The canonical SMILES for (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide is C=CC[C@H](C(N)=O)C(CC1CCC1)C(=O)NCC.
What is the InChIKey of (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide?
The InChIKey is QGVDAAYOCNUOCC-PXYINDEMSA-N. The full InChI is InChI=1S/C14H24N2O2/c1-3-6-11(13(15)17)12(14(18)16-4-2)9-10-7-5-8-10/h3,10-12H,1,4-9H2,2H3,(H2,15,17)(H,16,18)/t11-,12?/m0/s1.
What are the key properties of (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide?
(2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide has a molecular weight of 252.36 g/mol, XLogP of 1.61, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-(cyclobutylmethyl)-N'-ethyl-2-prop-2-enylbutanediamide is sourced from PubChem (CID 89313443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).