About 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol
2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol (PubChem CID 89313666) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol.
Molecular Properties
| Compound Name | 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol |
| PubChem CID | 89313666 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol |
| SMILES | C/C=C\[C@H](C)OC(C)(C)CO |
| InChI | InChI=1S/C9H18O2/c1-5-6-8(2)11-9(3,4)7-10/h5-6,8,10H,7H2,1-4H3/b6-5-/t8-/m0/s1 |
| InChIKey | URJGSMWKMNGTHI-SLGIHZDVSA-N |
| XLogP | 1.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol?
The IUPAC name of 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol (CID 89313666) is 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol.
What is the SMILES notation for 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol?
The canonical SMILES for 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol is C/C=C\[C@H](C)OC(C)(C)CO.
What is the InChIKey of 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol?
The InChIKey is URJGSMWKMNGTHI-SLGIHZDVSA-N. The full InChI is InChI=1S/C9H18O2/c1-5-6-8(2)11-9(3,4)7-10/h5-6,8,10H,7H2,1-4H3/b6-5-/t8-/m0/s1.
What are the key properties of 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol?
2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol has a molecular weight of 158.24 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(Z,2S)-pent-3-en-2-yl]oxypropan-1-ol is sourced from PubChem (CID 89313666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).