About 3-methyl-N-propyl-3,4-dihydropyridin-4-amine
3-methyl-N-propyl-3,4-dihydropyridin-4-amine (PubChem CID 89313762) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 3-methyl-N-propyl-3,4-dihydropyridin-4-amine.
Molecular Properties
| Compound Name | 3-methyl-N-propyl-3,4-dihydropyridin-4-amine |
| PubChem CID | 89313762 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 3-methyl-N-propyl-3,4-dihydropyridin-4-amine |
| SMILES | CCCNC1C=CN=CC1C |
| InChI | InChI=1S/C9H16N2/c1-3-5-11-9-4-6-10-7-8(9)2/h4,6-9,11H,3,5H2,1-2H3 |
| InChIKey | LKYMBKYIXRJHSV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-N-propyl-3,4-dihydropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-propyl-3,4-dihydropyridin-4-amine?
The IUPAC name of 3-methyl-N-propyl-3,4-dihydropyridin-4-amine (CID 89313762) is 3-methyl-N-propyl-3,4-dihydropyridin-4-amine.
What is the SMILES notation for 3-methyl-N-propyl-3,4-dihydropyridin-4-amine?
The canonical SMILES for 3-methyl-N-propyl-3,4-dihydropyridin-4-amine is CCCNC1C=CN=CC1C.
What is the InChIKey of 3-methyl-N-propyl-3,4-dihydropyridin-4-amine?
The InChIKey is LKYMBKYIXRJHSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-3-5-11-9-4-6-10-7-8(9)2/h4,6-9,11H,3,5H2,1-2H3.
What are the key properties of 3-methyl-N-propyl-3,4-dihydropyridin-4-amine?
3-methyl-N-propyl-3,4-dihydropyridin-4-amine has a molecular weight of 152.24 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-propyl-3,4-dihydropyridin-4-amine is sourced from PubChem (CID 89313762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).