About N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide
N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide (PubChem CID 89313763) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide |
| PubChem CID | 89313763 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide |
| SMILES | CC(=O)NC1C=CN=C[C@@H]1C |
| InChI | InChI=1S/C8H12N2O/c1-6-5-9-4-3-8(6)10-7(2)11/h3-6,8H,1-2H3,(H,10,11)/t6-,8?/m0/s1 |
| InChIKey | UXRVGXVXLASHNP-UUEFVBAFSA-N |
| XLogP | 0.73 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide?
The IUPAC name of N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide (CID 89313763) is N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide.
What is the SMILES notation for N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide?
The canonical SMILES for N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide is CC(=O)NC1C=CN=C[C@@H]1C.
What is the InChIKey of N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide?
The InChIKey is UXRVGXVXLASHNP-UUEFVBAFSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6-5-9-4-3-8(6)10-7(2)11/h3-6,8H,1-2H3,(H,10,11)/t6-,8?/m0/s1.
What are the key properties of N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide?
N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide has a molecular weight of 152.20 g/mol, XLogP of 0.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-3-methyl-3,4-dihydropyridin-4-yl]acetamide is sourced from PubChem (CID 89313763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).